BindingDB logo
myBDB logout

5 SMILES Strings for 5-Lipoxygenase (5-LOX)

Compound NameSMILES String
BDBM192705 COc1ccc2nc(NCC(O)COc3ccc4c(C)cc(=O)oc4c3)sc2c1
BDBM192701 Cc1cc(=O)oc2cc(OCC(O)CNc3nc4ccc(cc4s3)[N+]([O-])=O)ccc12
BDBM192703 Cc1cc(=O)oc2cc(OCC(O)CNc3nc4ccc(Cl)cc4s3)ccc12
BDBM192704 Cc1cc(=O)oc2cc(OCC(O)CNc3nc4cc(Cl)c(Cl)cc4s3)ccc12
BDBM192702 Cc1cc(=O)oc2cc(OCC(O)CNc3nc4cc(Cl)c(F)cc4s3)ccc12