BindingDB logo
myBDB logout

12 SMILES Strings for 5-alpha-Reductase (5α-Reductase)

Compound NameSMILES String
BDBM235659 CCc1ccc(cc1)C(=O)O[C@@]1(CCC2C3CCC4=C(Br)C(=O)CCC4(C)C3CCC12C)C(C)=O |r,c:19|
BDBM50025356 CC(C)(C)NC(=O)C1CCC2C3CCC4NC(=O)C=CC4(C)C3CCC12C |c:18|
BDBM233039 CC(C)(C)NC(=O)C1CCC2C3CCC4NC(=O)C=C[C@]4(C)C3CC[C@]12C |r,c:18|
BDBM233040 CC(=O)O[C@@]1(CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]12C)C(C)=O |r,t:11|
BDBM233041 CC(=O)O[C@@]1(CCC2C3C=CC4=CC(=O)CC[C@]4(C)C3CC[C@]12C)C(C)=O |r,c:9,t:11|
BDBM233042 CC(=O)O[C@@]1(CCC2C3[C@@H]4O[C@@H]4C4=CC(=O)CC[C@]4(C)C3CC[C@]12C)C(C)=O |r,t:13|
BDBM233043 CC(=O)O[C@@]1(CCC2C3C=C(Cl)C4=CC(=O)CC[C@]4(C)C3CC[C@]12C)C(C)=O |r,t:9,12|
BDBM235654 CC(=O)O[C@@]1(CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C)C(C)=O |r,t:11|
BDBM235655 CC(=O)[C@@]1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |r,t:11|
BDBM235656 CC(=O)[C@@]1(O)CCC2C3CCC4=C(Cl)C(=O)CCC4(C)C3CCC12C |r,c:11|
BDBM235657 CC(=O)[C@@]1(O)CCC2C3CCC4=C(Br)C(=O)CCC4(C)C3CCC12C |r,c:11|
BDBM235658 CCc1ccc(cc1)C(=O)O[C@@]1(CCC2C3CCC4=C(Cl)C(=O)CCC4(C)C3CCC12C)C(C)=O |r,c:19|