BindingDB logo
myBDB logout

1 SMILES String for 5-hydroxytryptamine receptor 1A (5HT1B)

Compound NameSMILES String
BDBM85097 Cc1cc2CCN(C(=O)Nc3ccc(Oc4cccnc4C)nc3)c2cc1Cl