BindingDB logo
myBDB logout

42 SMILES Strings for 6-phospho-1-fructokinase, putative

Compound NameSMILES String
BDBM50446088 Fc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2nncs2)cc1Cl
BDBM50446089 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2nncs2)cc1Cl
BDBM50446090 Fc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2nccs2)cc1Cl
BDBM50446091 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2nccs2)cc1Cl
BDBM50446092 CN(C)c1cccc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)c1
BDBM50446093 Oc1cccc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)c1
BDBM50446094 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2cncnc2)cc1Cl
BDBM50446095 OC(=O)c1ccc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)cc1
BDBM50446096 CCOC(=O)c1cccc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)c1
BDBM50446097 OC(=O)c1cccc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)c1
BDBM50446098 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)n(C)n1
BDBM50446099 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2ccn[nH]2)cc1Cl
BDBM50446100 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2ccon2)cc1Cl
BDBM50446101 Clc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2ccccc2)cc1Cl
BDBM50446102 OS(=O)(=O)c1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1
BDBM50446103 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)C(C)(C)c3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446104 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)CCc3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446105 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446106 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc4ccccc4c3)cc2)no1
BDBM50446107 COc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2cc(C)on2)cc1OC
BDBM50446108 COc1ccc(CC(=O)Nc2ccc(cc2)S(=O)(=O)Nc2cc(C)on2)cc1C
BDBM50446109 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(C)c(C)c3)cc2)no1
BDBM50446110 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(C)c(F)c3)cc2)no1
BDBM50446111 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(F)c(Cl)c3)cc2)no1
BDBM50446112 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(F)c3)cc2)no1
BDBM50446113 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(c3)C(F)(F)F)cc2)no1
BDBM50446114 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)cc3Cl)cc2)no1
BDBM50446115 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)cc3)cc2)no1
BDBM50446116 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3cccc(Cl)c3)cc2)no1
BDBM50446117 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccccc3)cc2)no1
BDBM50446118 Cc1cc(NS(=O)(=O)Cc2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446119 Cc1cc(NC(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446120 CN(c1cc(C)on1)S(=O)(=O)c1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1
BDBM50446121 Cc1cc(NS(=O)(=O)c2ccc(NS(=O)(=O)Cc3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446122 Cc1cc(NS(=O)(=O)c2ccc(cc2)C(=O)NCc2ccc(Cl)c(Cl)c2)no1
BDBM50446123 Cc1cc(NS(=O)(=O)c2ccc(NCCc3ccc(Cl)c(Cl)c3)cc2)no1
BDBM50446124 CN(C(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(cc1)S(=O)(=O)Nc1cc(C)on1
BDBM50446125 Cc1cc(NC(=O)c2csc(NC(=O)Cc3ccc(Cl)c(Cl)c3)n2)no1
BDBM50446126 Cc1cc(NS(=O)(=O)CCNC(=O)Cc2ccc(Cl)c(Cl)c2)no1
BDBM50446127 Cc1cc(NS(=O)(=O)C2CCN(CC2)C(=O)Cc2ccc(Cl)c(Cl)c2)no1
BDBM50446128 Cc1cc(NS(=O)(=O)c2cccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)c2)no1
BDBM50446129 Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)no1