BindingDB logo
myBDB logout

6 SMILES Strings for 6-phosphogluconate dehydrogenase, decarboxylating

Compound NameSMILES String
BDBM50148780 CC1(C)O[C@H](COP(O)(O)=O)[C@@H](O1)C(=O)NO
BDBM50148790 O[C@H](COP(O)(O)=O)[C@@H](O)C([O-])=O
BDBM50148765 CC(=O)O[C@H](COP(O)(O)=O)[C@@H](OC(C)=O)C(=O)NO
BDBM50148767 ONC(=O)[C@H](O)[C@H](O)COP(O)(O)=O
BDBM50322321 O[C@@H](COP(O)(O)=O)[C@H](O)[C@H](O)C(O)=O |r|
BDBM50322320 O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)CC(O)=O |r|