BindingDB logo
myBDB logout

5 SMILES Strings for 6-phosphogluconate dehydrogenase, decarboxylating, putative

Compound NameSMILES String
BDBM50148780 CC1(C)O[C@H](COP(O)(O)=O)[C@@H](O1)C(=O)NO
BDBM50148765 CC(=O)O[C@H](COP(O)(O)=O)[C@@H](OC(C)=O)C(=O)NO
BDBM50148767 ONC(=O)[C@H](O)[C@H](O)COP(O)(O)=O
BDBM50148769 NC(=O)[C@H](O)[C@H](O)COP(O)(O)=O
BDBM50342610 ONC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(O)(O)=O |r|