BindingDB logo
myBDB logout

29 SMILES Strings for 6-phosphogluconate dehydrogenase (6PGD)

Compound NameSMILES String
BDBM23417 O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |r|
BDBM25902 NS(=O)(=O)c1cc(C(O)=O)c(NCc2ccco2)cc1Cl
BDBM48320 CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC
BDBM87063 CC(CCC(=O)Nc1nnc(s1)S(N)(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C
BDBM87064 CC(CCC(=O)Nc1nnc(s1)S(N)(=O)=O)C1CCC2C3C(CC4CC(CCC4(C)C3CC(OC(C)=O)C12C)OC(C)=O)OC(C)=O
BDBM94597 [#6]-[#7]-1-[#6]-[#6]\[#6](-[#6]-[#6]-1)=[#6]-1/c2ccsc2-[#6](=O)-[#6]-c2ccccc-12
BDBM97162 C[C@H](NCCc1ccc(O)cc1)[C@H](O)c1ccc(O)cc1
BDBM50043906 CCNC1CC(C)S(=O)(=O)c2sc(cc12)S(N)(=O)=O
BDBM50056998 CN1C(C(=O)Nc2ncc(C)s2)=C(O)c2ccccc2S1(=O)=O |t:12|
BDBM50070942 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1cc(O)c(O)c(O)c1 |r|
BDBM50135169 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@@H](Oc2c1)c1ccc(O)c(O)c1
BDBM50148777 CC(O)(C(O)COP(O)([O-])[O-])C(O)C(O)C([O-])=O
BDBM50148778 CC1(C)O[C@H](COP(O)(O)=O)[C@@H](O1)C(N)=O
BDBM50148779 CC(=O)O[C@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)[C@@H](OC(C)=O)C(=O)N(OCc1ccccc1)C(C)=O
BDBM50148780 CC1(C)O[C@H](COP(O)(O)=O)[C@@H](O1)C(=O)NO
BDBM50148785 CC(=O)O[C@H](COP(O)(O)=O)CS(=O)CC(O)=O
BDBM50148786 CC(O)(C(O)COP(O)([O-])[O-])C(O)CC([O-])=O
BDBM50148790 O[C@H](COP(O)(O)=O)[C@@H](O)C([O-])=O
BDBM50148765 CC(=O)O[C@H](COP(O)(O)=O)[C@@H](OC(C)=O)C(=O)NO
BDBM50148767 ONC(=O)[C@H](O)[C@H](O)COP(O)(O)=O
BDBM50148769 NC(=O)[C@H](O)[C@H](O)COP(O)(O)=O
BDBM50148770 O[C@H](COP(O)(O)=O)CS(=O)CC(O)=O
BDBM50153015 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@H](Oc2c1)c1ccc(O)c(O)c1 |r|
BDBM50187665 O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1 |r|
BDBM50236527 O[C@@H]1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1 |r|
BDBM50236531 Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@@H](Oc2c1)c1cc(O)c(O)c(O)c1
BDBM50373220 O[C@@H]1Cc2c(O)cc(O)cc2O[C@H]1c1cc(O)c(O)c(O)c1
BDBM233150 OC(=O)CN(CCN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O)CC([O-])=O
BDBM18050 CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(cc1)C(=O)N[C@@H](CCC(O)=O)C(O)=O |r|