BindingDB logo
myBDB logout

6 SMILES Strings for 7-dehydrocholesterol reductase

Compound NameSMILES String
BDBM50406616 C[C@H](CCc1nccn1C)C1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |c:16|
BDBM50406617 C[C@H](CCC(N)=N)C1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |r,c:12|
BDBM50406618 [#6]-[#6@H](-[#6]-[#6]\[#6](-[#7])=[#7+](/[#6])-[#6])-[#6]1-[#6]-[#6][C@@]2([#6])[#6]-3=[#6](-[#6]-[#6][C@]12[#6])[C@@]1([#6])[#6]-[#6]-[#6@H](-[#8])C([#6])([#6])[#6]1-[#6]-[#6]-3 |c:14|
BDBM50406619 CC(C)SCC[C@@H](C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |t:14|
BDBM50406620 C[C@H](CCc1ncc[nH]1)C1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |c:15|
BDBM50406621 C[C@H](CC[S+](C)C(C)C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |t:15|