BindingDB logo
myBDB logout

20 SMILES Strings for 8-Oxoguanine DNA glycosylase-1 (OGG1)

Compound NameSMILES String
BDBM81461 NNc1nncc2ccccc12
BDBM50106186 NC(=O)c1ccc(Br)cc1
BDBM163679 NNC(=O)c1sc2cccc(Cl)c2c1Cl
BDBM163680 CC1CCCC\C1=N\NC(=O)c1sc2ccccc2c1Cl
BDBM163681 Fc1ccc(\C=N\NC(=O)c2sc3ccccc3c2Cl)cc1
BDBM163687 C\C(=N/NC(=O)c1cc2ccccc2cc1O)c1ccc2OCOc2c1
BDBM163688 [#6]-[#6]-[#6]-[#7]-1-[#6]-[#6]\[#6](-[#6]-[#6]-1)=[#7]/[#7]-[#6](=O)-c1ccc(Cl)cc1Cl
BDBM163689 C\C(CCC=C)=N\NC(=O)c1cccc(Br)c1
BDBM163686 NNC(=O)COc1cccc2ccccc12
BDBM163690 CCCC\C(C)=N/NC(=O)c1cccc(Br)c1
BDBM163694 NNC(=O)c1sc2ccccc2c1Cl
BDBM163695 NNC(=O)c1ccc(Br)cc1
BDBM163693 O=C(CCNNC(=O)c1ccncc1)NCc1ccccc1
BDBM163683 [#8]-c1cc2ccccc2cc1-[#6](=O)-[#7]\[#7]=[#6]-1/[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM163682 Brc1ccc(cc1)-[#6](=O)-[#7]\[#7]=[#6]-1/[#6]-[#6]-[#6]-[#6]-[#6]-1
BDBM163684 CC(Oc1cccc(Cl)c1)C(=O)NN
BDBM163685 Cc1cc(OCC(=O)NN)cc(C)c1Cl
BDBM163691 COc1cc(C)c(cc1C)S(=O)(=O)n1cc(C)nc1-c1ccccc1
BDBM163692 Cc1cc(no1)C(=O)NNCc1ccccc1
BDBM50336507 NNC(=O)c1ccncc1