BindingDB logo
myBDB logout

5 SMILES Strings for ADAM12

Compound NameSMILES String
BDBM50062351 CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)CC(=O)NO |r|
BDBM50156475 CC(NC(=O)C(\NC(=O)c1ccc(Br)o1)=C/c1ccc(Br)cc1)C(O)=O
BDBM50156476 CC(C)C(NC(=O)C(\NC(=O)c1ccccc1)=C/c1ccccc1F)C(O)=O
BDBM50156477 OC(=O)CNC(=O)C(\NC(=O)c1ccco1)=C/c1cccc(Br)c1
BDBM50156478 CC(NC(=O)C(\NC(=O)c1ccco1)=C/c1ccco1)C(O)=O