BindingDB logo
myBDB logout

1 SMILES String for ADAMTS5

Compound NameSMILES String
BDBM50431947 OC(=O)CCc1sc(\C=C2/NC(=O)CS2)nc1-c1ccccn1