BindingDB logo
myBDB logout

2 SMILES Strings for ADC-18 protein

Compound NameSMILES String
BDBM50021954 CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |r|
BDBM50021959 OC\C=C1/O[C@@H]2CC(=O)N2[C@H]1C(O)=O |r|