BindingDB logo
myBDB logout

5 SMILES Strings for ADENOSINE A2

Compound NameSMILES String
BDBM50009525 Nc1nc(Cl)nc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |r|
BDBM82071 COc1ccc(cc1)C(CN(C)C)C1(O)CCCCC1
BDBM84745 CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |r|
BDBM86748 CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1
BDBM50022784 CNCCC(Oc1ccccc1C)c1ccccc1