BindingDB logo
myBDB logout

5 SMILES Strings for ADRA2B

Compound NameSMILES String
BDBM82071 COc1ccc(cc1)C(CN(C)C)C1(O)CCCCC1
BDBM84745 CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |r|
BDBM86757 COc1ccccc1N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1
BDBM50022784 CNCCC(Oc1ccccc1C)c1ccccc1
BDBM50084959 CN1CCC2(COc3cc4CCN(C(=O)c5ccc(cc5)-c5ccc(cc5C)-c5noc(C)n5)c4cc23)CC1