BindingDB logo
myBDB logout

45 SMILES Strings for ADRA2C

Compound NameSMILES String
BDBM21393 CCCN(CCC)C1CCc2cccc(O)c2C1
BDBM21395 Fc1ccc(cc1)C(=O)C1CCN(CCn2c(=O)[nH]c3ccccc3c2=O)CC1
BDBM22869 CN1CCN(CC1)C1=c2ccccc2=Nc2ccc(Cl)cc2N1 |c:8,15|
BDBM29568 COc1cc2nc(nc(N)c2cc1OC)N1CCN(CC1)C(=O)c1ccco1
BDBM30712 Cc1cc(c(O)c(C)c1CC1=NCCN1)C(C)(C)C |t:11|
BDBM31046 Cc1ccc(cc1)N(CC1=NCCN1)c1cccc(O)c1 |t:10|
BDBM30993 COC(=O)C1=COC(C)C2CN3CCc4c([nH]c5ccccc45)C3CC12 |t:4|
BDBM35256 [H][C@]12CN(C)CCN1c1ccccc1Cc1ccccc21 |r|
BDBM55436 C(C1=NCCN1)c1ccccc1 |t:1|
BDBM60917 Oc1ccc(cc1)C1CNCCc2c(Cl)c(O)c(O)cc12
BDBM66983 CN1CCc2cccc(Cl)c2CC1
BDBM78433 OCCN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1
BDBM81444 COc1cccc(OC)c1OCCNCC1Oc2ccccc2OC1c1ccccc1
BDBM81802 CN1CCN(CC1)C1=Nc2ccccc2Sc2nccn12 |t:8|
BDBM81803 CCOC1(COc2ccccc2O1)C1=NCCN1 |t:15|
BDBM81804 Clc1cccc2-[#6]-[#7](-[#6]-c12)\[#7]=[#6]-1\[#7]-[#6]-[#6]-[#7]-1
BDBM81805 C=CCN1Cc2ccccc2-c2ccccc2C1
BDBM81806 C=CCn1c(cc2ccccc12)C1=NCCN1 |t:14|
BDBM81807 CCC1(Cc2ccccc2C1)c1cnc[nH]1
BDBM81808 CCCS(=O)(=O)N(C)C1CCN2CCc3ccccc3C2C1
BDBM81809 Oc1ccc(CCNCC2CCc3ccccc3C2=O)cc1
BDBM81810 CS(=O)(=O)NCCN(C1CCN2CCc3ccccc3C2C1)S(C)(=O)=O
BDBM81811 CN1CCC2(CCN3CCc4c(oc5ccccc45)C3C2)N(C)C1=O
BDBM81812 CN(C)CCCN1c2ccc(O)cc2Sc2ccc(Cl)cc12
BDBM81813 Cc1cccc(C)c1CCc1cnc[nH]1
BDBM81814 Cc1nc2SCCn2c(=O)c1CCN1CCC(CC1)C(=O)c1ccc(F)cc1
BDBM81815 CCOc1ccc(CC(NC(=O)CC2(S)CCCCC2)C(=O)NC(Cc2ccccc2)C(=O)NC(C(C)C)C(=O)NC(CC(N)=O)C(=O)NC(C=S)C(=O)NC(CCCCN)C(N)=O)cc1
BDBM81816 CCCCS(=O)(=O)N(C)[C@H]1CCN2CCc3ccccc3[C@H]2C1
BDBM81772 COc1ccccc1N1CCN(CCC2C(=O)c3ccccc3C(C)(C)C2=O)CC1
BDBM81773 CN1C[C@H](Cn2ccnc2-c2ccccc2)C[C@H]2[C@H]1Cc1c(Br)[nH]c3cccc2c13 |r|
BDBM86757 COc1ccccc1N1CCN(CCCCn2ncc(=O)n(C)c2=O)CC1
BDBM50002151 C1CN(CCN1)c1nccn2ccnc12
BDBM50001888 CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12
BDBM50002338 CSc1ccc2Sc3ccccc3N(CCC3CCCCN3C)c2c1
BDBM50008735 CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc([C@@H]2C1)c34
BDBM50013515 COC(=O)[C@H]1[C@@H](O)CC[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]12 |r|
BDBM50017720 C(C1COc2ccccc2O1)N1CCCCC1
BDBM50017452 Clc1cncc(n1)N1CCNCC1
BDBM50019848 C1CN=C(N1)C1COc2ccccc2O1 |c:2|
BDBM50019855 CN1C(Cc2cc(F)ccc12)C1=NCCN1 |t:13|
BDBM50020192 O=C1NCN(c2ccccc2)C11CCN(CC2COc3ccccc3O2)CC1
BDBM50027024 Fc1cccnc1N1CCNCC1
BDBM50030622 COC(=O)C1=CO[C@@H](C)[C@@H]2CN3CCc4c([nH]c5ccccc45)[C@H]3C[C@H]12 |t:4|
BDBM50030623 [#6]-[#7]-1-[#6]-[#6]-c2c(Cl)ccc(-[#8]-[#6]\[#6]=[#6](\[#6])-[#6])c2-[#6]-[#6]-1
BDBM50240671 Clc1ccc2nsnc2c1NC1=NCCN1 |t:13|