BindingDB logo
myBDB logout

2 SMILES Strings for ALK tyrosine kinase receptor (C1156Y)

Compound NameSMILES String
BDBM50306682 C[C@@H](Oc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl |r|
BDBM199945 C[C@@H](Oc1cc(cnc1N)-c1cnn(c1)C1CC2(C1)CCNCC2)c1c(Cl)ccc(F)c1Cl |r|