BindingDB logo
myBDB logout

3 SMILES Strings for ALK tyrosine kinase receptor (G1269S)

Compound NameSMILES String
BDBM261686 COc1cc(ncc1-c1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1)N1CCNC[C@@H]1C |r|
BDBM261689 COc1cc(cnc1C1=CCNCC1)-c1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1 |r,t:9|
BDBM261711 CCOc1cc(ncc1-c1cnc(N)c(O[C@H](C)c2c(Cl)ccc(F)c2Cl)c1)N1CCNC[C@@H]1C |r|