BindingDB logo
myBDB logout

5 SMILES Strings for ALK1

Compound NameSMILES String
BDBM36354 CC(C)Oc1ccc(cc1)-c1cnc2c(cnn2c1)-c1ccnc2ccccc12
BDBM102618 C1CN(CCN1)c1ccc(cc1)-c1cnc2c(cnn2c1)-c1cccc2ncccc12
BDBM102619 COc1cc(cc(OC)c1OC)-c1cc(cnc1N)-c1cccc(O)c1
BDBM50262685 C(CN1CCCCC1)Oc1ccc(cc1)-c1cnc2c(cnn2c1)-c1ccncc1
BDBM50262079 C1CN(CCN1)c1ccc(cc1)-c1cnc2c(cnn2c1)-c1ccnc2ccccc12