BindingDB logo
myBDB logout

15 SMILES Strings for ALX receptor and the G-protein Gα16

Compound NameSMILES String
BDBM230850 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1cccc(C)c1
BDBM230851 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C3(O)CC3)n2)c(o1)-c1cccc(C)c1
BDBM230852 CC(C)(O)c1coc(Cn2ncc(NC(=O)c3ncoc3-c3ccccc3)n2)n1
BDBM230853 CC(C)(O)c1coc(Cn2ncc(NC(=O)c3ncoc3-c3ccc(F)cc3)n2)n1
BDBM230854 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1cccc(c1)C(F)(F)F
BDBM230855 COc1cccc(c1)-c1oc(C)nc1C(=O)Nc1cnn(Cc2nc(co2)C(C)(C)O)n1
BDBM230856 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1cccc(Cl)c1
BDBM230857 CC(C)(O)c1coc(Cn2ncc(NC(=O)c3ncoc3-c3cccc(Cl)c3)n2)n1
BDBM230859 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1ccccc1
BDBM230858 COc1cccc(c1)-c1ocnc1C(=O)Nc1cnn(Cc2nc(co2)C(C)(C)O)n1
BDBM230860 CC(C)(O)c1coc(Cn2ncc(NC(=O)c3ncsc3-c3cccc(F)c3)n2)n1
BDBM230861 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1cccc(OC(F)(F)F)c1
BDBM230862 Cc1nc(C(=O)Nc2cnn(Cc3nc(co3)C(C)(C)O)n2)c(o1)-c1cccc(F)c1
BDBM230863 Cc1cccc(c1)-c1ocnc1C(=O)Nc1cnn(Cc2nc(co2)C(C)(C)O)n1
BDBM230864 Cc1cccc(c1)-c1oc(nc1C(=O)Nc1cnn(Cc2nc(co2)C(C)(C)O)n1)C1CC1