BindingDB logo
myBDB logout

1 SMILES String for AMP deaminase

Compound NameSMILES String
BDBM50004698 O[C@@H]1[C@@H](COP(O)(O)=O)O[C@H]([C@@H]1O)c1n[nH]c2cncnc12 |r|