BindingDB logo
myBDB logout

2 SMILES Strings for AMP deaminase 1

Compound NameSMILES String
BDBM50004698 O[C@@H]1[C@@H](COP(O)(O)=O)O[C@H]([C@@H]1O)c1n[nH]c2cncnc12 |r|
BDBM50004699 O[C@@H]1[C@@H](COP(O)(O)=O)O[C@H]([C@@H]1O)n1cnc2cncnc12 |r|