BindingDB logo
myBDB logout

3 SMILES Strings for AMP deaminase 1 (mAMPD1)

Compound NameSMILES String
BDBM154582 C[C@@H](NCc1ccc(cc1)-c1ccc(cn1)C(O)=O)c1cccc2ccncc12 |r|
BDBM154583 C[C@H](NCc1ccc(cc1)-c1ccc(cn1)C(O)=O)c1cccc2ccncc12 |r|
BDBM154584 COc1cc(ccc1C(O)=O)-c1ccc(CN[C@H](C)c2cccc3ccncc23)cc1 |r|