BindingDB logo
myBDB logout

2 SMILES Strings for AMP deaminase 3 (rAMPD3)

Compound NameSMILES String
BDBM154582 C[C@@H](NCc1ccc(cc1)-c1ccc(cn1)C(O)=O)c1cccc2ccncc12 |r|
BDBM154583 C[C@H](NCc1ccc(cc1)-c1ccc(cn1)C(O)=O)c1cccc2ccncc12 |r|