BindingDB logo
myBDB logout

1 SMILES String for AMP-activated protein kinase, alpha-1 subunit

Compound NameSMILES String
BDBM50242401 Oc1ccccc1-c1ccc(cc1)-c1csc2[nH]c(=O)c(C#N)c(O)c12