BindingDB logo
myBDB logout

3 SMILES Strings for AMPK alpha2/beta2/gamma3

Compound NameSMILES String
BDBM237920 OC(=O)c1c[nH]c2cc(Cl)c(cc12)-c1ccc(cc1)C1(O)CCC1
BDBM50195534 [H][C@]12OC[C@@H](Oc3nc4cc(c(Cl)cc4[nH]3)-c3ccc(cc3)-c3c(O)cccc3O)[C@@]1([H])OC[C@H]2O |r|
BDBM50195479 OC(=O)c1c[nH]c2ccc(cc12)-c1ccc(cc1)-c1c(O)cccc1O