BindingDB logo
myBDB logout

20 SMILES Strings for AP-4-A phosphorylase

Compound NameSMILES String
BDBM65556 CS\C(Nc1ccccc1C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65554 CS\C(Nc1cccc(c1)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65558 CS\C(Nc1ccc(cc1)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65548 CS\C(Nc1cccc(c1)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccc(Cl)cc1
BDBM65551 CS\C(Nc1ccccc1)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65552 CS\C(Nc1ccccc1)=C(\C#N)S(=O)(=O)c1ccc(Cl)cc1
BDBM65560 CS\C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65563 CCCS\C(Nc1cccc(c1)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65562 CCS\C(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65572 CCCc1cccc(N\C(SC)=C(/C#N)S(=O)(=O)c2ccccc2)c1
BDBM65569 CS\C(Nc1cccc(c1)C#N)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65570 COC(=O)c1cccc(N\C(SC)=C(/C#N)S(=O)(=O)c2ccccc2)c1
BDBM65568 CS\C(Nc1cccc(c1)[N+]([O-])=O)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65571 CCc1cccc(N\C(SC)=C(/C#N)S(=O)(=O)c2ccccc2)c1
BDBM65564 CC(C)S\C(Nc1cccc(c1)C(F)(F)F)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65577 COc1cccc(N\C(SC)=C(/C#N)S(=O)(=O)c2ccccc2)c1
BDBM65578 CS\C(Nc1cc(C)cc(C)c1)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65573 CS\C(Nc1cccc(c1)C(C)C)=C(\C#N)S(=O)(=O)c1ccccc1
BDBM65565 FC(F)(F)c1cccc(N\C(SCc2ccccc2)=C(/C#N)S(=O)(=O)c2ccccc2)c1
BDBM65567 CS\C(Nc1cccc(C)c1)=C(\C#N)S(=O)(=O)c1ccccc1