BindingDB logo
myBDB logout

6 SMILES Strings for ATIII/alphaIIa

Compound NameSMILES String
BDBM264648 CCCCCCCCNC(=O)c1cc(O)c(O)c(O)c1
BDBM264597 CCCCCCCCN(S(=O)(=O)c1ccc(O)c(O)c1)S(=O)(=O)c1cc(F)c(O)c(F)c1
BDBM264598 CCCCCCCCN(S(=O)(=O)c1cc(F)c(O)c(F)c1)S(=O)(=O)c1cc(F)c(O)c(F)c1
BDBM264613 CCCCCCCCCCN(S(=O)(=O)c1ccc(O)c(O)c1)S(=O)(=O)c1ccc(O)c(O)c1
BDBM264614 CCCCCCCCCCCCN(S(=O)(=O)c1ccc(O)c(O)c1)S(=O)(=O)c1ccc(O)c(O)c1
BDBM264627 Oc1ccc(cc1O)S(=O)(=O)NCc1ccccc1