BindingDB logo
myBDB logout

11 SMILES Strings for ATP Phosphoribosyltransferase

Compound NameSMILES String
BDBM25324 CCOC(=O)C(=O)Nc1nc2ccc(cc2s1)[N+]([O-])=O
BDBM25325 CN(CC(O)=O)c1nc2ccc(cc2s1)[N+]([O-])=O
BDBM25314 O=C(CSc1nnc(-c2ccccc2)c(n1)-c1ccccc1)Nc1nccs1
BDBM25316 [O-][N+](=O)c1ccc2nc(NC(=O)CC(NC(=O)c3ccccc3)c3ccccc3)sc2c1
BDBM25317 Oc1cc(c2cc(ccc2c1N=Nc1ccc2ccccc2c1O)[N+]([O-])=O)S(O)(=O)=O |w:12.14|
BDBM25318 COc1ccc(COC(=O)C2=C(C)N=C3CC(CC(=O)C3C2c2cccs2)c2cccs2)cc1 |c:10,t:13|
BDBM25319 Nc1nc(SCc2ccccc2)c(N)c(SCc2ccccc2)n1
BDBM25320 Cc1cc(\N=N\c2ccc(cc2)S(O)(=O)=O)c(N)c(\N=N\c2ccc(cc2)S(O)(=O)=O)c1N
BDBM25321 COc1cc(cc(OC)c1OC)C1C(C(=O)c2ccc(Cl)cc2)C(=O)C(=O)N1Cc1cccnc1
BDBM25322 [O-][N+](=O)c1cc(C(=O)NNC(=O)Nc2ccccc2)c(Br)c(c1)[N+]([O-])=O
BDBM25323 Oc1cccc(Nc2cc(Nc3ccc(cc3O)[N+]([O-])=O)c([N+]([O-])=O)c3nonc23)c1