BindingDB logo
myBDB logout

5 SMILES Strings for ATP-dependent Clp protease proteolytic subunit

Compound NameSMILES String
BDBM50360279 C=CCCCCCCC[C@@H]1[C@@H](CCc2ccccc2)OC1=O |r|
BDBM50360280 C=CCCCCCCC[C@@H]1[C@@H](CCc2cccnc2)OC1=O |r|
BDBM50360281 CN(C)c1ccc(cc1)C(=O)NCCCCC[C@H]1OC(=O)[C@@H]1CCCCCCCC=C |r|
BDBM50028480 [H][C@@]12CCCN1C(=O)[C@H](COC(=O)[C@]1([H])C[C@@H](C)CN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C2=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)\C=C\C=C\C=C\C |r|
BDBM50028481 [H][C@@]12CCCN1C(=O)[C@H](C)NC(=O)[C@H](C)N(C)C(=O)[C@]1([H])CCCN1C(=O)[C@H](COC2=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)\C=C\C=C\C=C\C |r|