BindingDB logo
myBDB logout

7 SMILES Strings for ATP-dependent RNA helicase DDX1

Compound NameSMILES String
BDBM82820 [O-][N+](=O)c1cccc(NC(=O)Nc2cccc(c2)[N+]([O-])=O)c1
BDBM50379305 Cc1ccccc1NC(=O)Nc1cccc(N)c1
BDBM50379306 Cc1[nH]c2ccccc2c1C1=CC(=NN=C(C1)c1ccccc1)c1ccccc1 |c:14,16,t:12|
BDBM50379301 Nc1cccc(NC(=O)Nc2cccc(N)c2)c1
BDBM50379302 Cc1ccccc1NC(=O)Nc1cccc(c1)[N+]([O-])=O
BDBM50379303 Cc1ccccc1NC(=O)Nc1cccc(NC(=O)Nc2ccccc2C)c1
BDBM50379304 O=C(Nc1ccc(cc1)-c1nc2ccccc2[nH]1)c1cc2ccccc2o1