BindingDB logo
myBDB logout

17 SMILES Strings for ATP-dependent RNA helicase DDX3X

Compound NameSMILES String
BDBM82820 [O-][N+](=O)c1cccc(NC(=O)Nc2cccc(c2)[N+]([O-])=O)c1
BDBM50274022 Oc1cccc(NC(=O)CCN2C(=S)S\C(=C/c3cccc(Br)c3)C2=O)c1
BDBM50274023 Oc1ccc(NC(=O)CCN2C(=S)S\C(=C/c3cccc(Br)c3)C2=O)cc1
BDBM50274024 Oc1ccccc1NC(=O)CCN1C(=S)S\C(=C/c2cccc(Br)c2)C1=O
BDBM50274025 Oc1cccc(NC(=O)CCCN2C(=S)S\C(=C/c3cccc(Br)c3)C2=O)c1
BDBM50274184 OC(=O)c1ccccc1NC(=O)CCN1C(=S)S\C(=C/c2cccc(Br)c2)C1=O
BDBM50274220 Nc1c(C#N)c(nn1-c1ccccc1)C(=C\c1ccc(o1)-c1ccccc1[N+]([O-])=O)\C#N
BDBM50274221 Nc1[nH]nc(C(=Cc2ccc(o2)-c2cccc(c2)[N+]([O-])=O)C#N)c1C#N |w:6.6|
BDBM50274222 Nc1c(C#N)c(nn1-c1ccccc1)C(=C\c1ccc(o1)-c1cccc(Cl)c1)\C#N
BDBM50274780 Oc1ccccc1NC(=O)CCCN1C(=S)S\C(=C/c2cccc(Br)c2)C1=O
BDBM50274781 COc1ccccc1\C=C1/SC(=S)N(CCC(=O)Nc2cccc(O)c2)C1=O
BDBM50379305 Cc1ccccc1NC(=O)Nc1cccc(N)c1
BDBM50379306 Cc1[nH]c2ccccc2c1C1=CC(=NN=C(C1)c1ccccc1)c1ccccc1 |c:14,16,t:12|
BDBM50379301 Nc1cccc(NC(=O)Nc2cccc(N)c2)c1
BDBM50379302 Cc1ccccc1NC(=O)Nc1cccc(c1)[N+]([O-])=O
BDBM50379303 Cc1ccccc1NC(=O)Nc1cccc(NC(=O)Nc2ccccc2C)c1
BDBM50379304 O=C(Nc1ccc(cc1)-c1nc2ccccc2[nH]1)c1cc2ccccc2o1