BindingDB logo
myBDB logout

1 SMILES String for ATP-dependent RNA helicase DHX29

Compound NameSMILES String
BDBM65493 Clc1ccc(cc1)[C@H]1CN(CCN1C(=O)c1ccc(Br)cc1)C(=O)c1cnn2cc(Br)ccc12 |r|