BindingDB logo
myBDB logout

7 SMILES Strings for ATP-dependent clamp loaders gp44/62 (R175K)

Compound NameSMILES String
BDBM36312 [H][C@@]1(O)C(COP(O)(=O)OP(O)(=O)OP(O)(O)=S)OC(n2cnc3c(N)ncnc23)[C@]1([H])O
BDBM36316 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2cc(CC)ccc12
BDBM36317 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2cc(C=C)ccc12
BDBM36318 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2cc(ccc12)C(O)=O
BDBM36319 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2cc(ccc12)[N+]([O-])=O
BDBM36323 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2c(cccc12)[N+]([O-])=O
BDBM36324 [H][C@]1(O)C[C@@]([H])(O[C@]1([H])COP(O)(=O)OP(O)(=O)OP(O)(O)=O)n1ccc2ccc(cc12)[N+]([O-])=O