BindingDB logo
myBDB logout

1 SMILES String for AbDsbA(ox)/AFDQIDNAPEE

Compound NameSMILES String
BDBM231642 CC(C)C[C@H](NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1)C(O)=O |r|