BindingDB logo
myBDB logout

29 SMILES Strings for Acetolactate synthase

Compound NameSMILES String
BDBM50004706 Cc1ccn2nc(nc2n1)S(=O)(=O)Nc1c(F)ccc2cccnc12
BDBM50004709 Cc1ccn2nc(nc2n1)S(=O)(=O)Nc1c(Br)ccc2cccnc12
BDBM50004712 Cc1ccn2nc(nc2n1)S(=O)(=O)Nc1c(Cl)ccc2cccnc12
BDBM50004719 Cc1cc(C)n2nc(nc2n1)S(=O)(=O)Nc1cccc2cccnc12
BDBM50004746 Cc1cc(C)n2nc(nc2n1)S(=O)(=O)Nc1c(Br)ccc2cccnc12
BDBM50004747 Cc1cc(C)n2nc(nc2n1)S(=O)(=O)Nc1c(Cl)ccc2cccnc12
BDBM50004707 Cc1cc(C)n2nc(nc2n1)S(=O)(=O)Nc1c(F)ccc2cccnc12
BDBM50004708 Cc1ccn2nc(nc2n1)S(=O)(=O)Nc1c(F)cccc1F
BDBM50004717 Cc1ccn2nc(nc2n1)S(=O)(=O)Nc1c(ccc2cccnc12)C#N
BDBM50079601 Cc1ccnc(NS(=O)(=O)c2ccccc2[N+]([O-])=O)n1
BDBM50079602 Cc1cc(C)nc(NS(=O)(=O)c2cc(Cl)ccc2Cl)n1
BDBM50079603 Cc1ccnc(NS(=O)(=O)c2ccc(Br)cc2)n1
BDBM50079604 Cc1cnc(NS(=O)(=O)c2cc(Cl)ccc2Cl)s1
BDBM50079605 Cc1ccc(NS(=O)(=O)c2ccc(F)cc2)nc1
BDBM50079606 Cc1ccnc(NS(=O)(=O)c2cc(Cl)ccc2Cl)n1
BDBM50079607 Clc1ccc(Cl)c(c1)S(=O)(=O)Nc1nccs1
BDBM50079608 COc1cc(Cl)nc(NS(=O)(=O)c2ccc(F)cc2)n1
BDBM50079609 Cc1ccnc(NS(=O)(=O)c2ccc(F)cc2)n1
BDBM50216773 Ic1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216774 Fc1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50424585 CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(Cl)cc(OC)n1
BDBM50216776 COc1ccccc1C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216778 Clc1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216779 FC(F)(F)c1cc(Cl)c(C(=O)OCn2ccc(=O)[nH]c2=O)c(Cl)c1
BDBM50216780 O=C(OCn1ccc(=O)[nH]c1=O)c1ccccc1
BDBM50216781 [O-][N+](=O)c1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216782 Cc1cccc(c1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216775 Brc1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O
BDBM50216783 COc1ccc(cc1)C(=O)OCn1ccc(=O)[nH]c1=O