BindingDB logo
myBDB logout

4 SMILES Strings for Acetyl-CoA carboxylase

Compound NameSMILES String
BDBM50189627 CC(C)Oc1ccc(Oc2ccc(cc2)C#CC(C)NC(C)=O)cc1
BDBM50198333 CCOc1ccc(Oc2ccc(cc2)-c2noc(n2)C(C)NC(C)=O)cc1
BDBM50198339 CCCCCCOc1ccc(Oc2ccc(cc2)-c2noc(n2)C(C)NC(C)=O)cc1
BDBM50198340 C[C@H](NC(C)=O)c1nc(no1)-c1ccc(Oc2ccc(Oc3ccccc3)cc2)cc1 |r|