BindingDB logo
myBDB logout

10 SMILES Strings for Acetyl-CoA carboxylase 1

Compound NameSMILES String
BDBM220133 CO[C@@]1(C)CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)c(F)c1 |r,wU:6.9,2.2,wD:2.1,c:13,(-7.42,-2.62,;-6.09,-1.85,;-6.09,-.31,;-7.42,.46,;-4.75,-1.08,;-3.42,-.31,;-3.42,1.23,;-4.75,2,;-6.09,1.23,;-3.42,2.77,;-1.95,3.25,;-1.18,4.58,;-1.05,2,;-1.95,.75,;-1.18,-.58,;.49,2,;1.26,.67,;2.8,.67,;3.57,2,;2.8,3.33,;1.26,3.33,;.49,4.67,;3.57,-.67,;2.8,-2,;3.57,-3.33,;5.11,-3.33,;5.88,-4.67,;5.88,-2,;7.42,-2,;5.11,-.67,)|
BDBM220131 Cc1ccc(cc1C1=C(O)[C@]2(CC[C@@H](CC2)C(F)(F)F)NC1=O)-c1ccc(Cl)cc1 |r,wU:10.21,13.17,c:8,(1.93,4.67,;2.7,3.33,;4.24,3.33,;5.01,2,;4.24,.67,;2.7,.67,;1.93,2,;.39,2,;-.52,.75,;.25,-.58,;-1.98,1.23,;-3.32,2,;-4.65,1.23,;-4.65,-.31,;-3.32,-1.08,;-1.98,-.31,;-5.98,.46,;-7.32,-.31,;-5.98,2,;-7.32,1.23,;-1.98,2.77,;-.52,3.25,;.25,4.58,;5.01,-.67,;4.24,-2,;5.01,-3.33,;6.55,-3.33,;7.32,-4.67,;7.32,-2,;6.55,-.67,)|
BDBM220134 Cc1ccc(cc1C1=C(O)[C@]2(CC[C@@H](CC2)C(F)(F)F)NC1=O)-c1ccc(Cl)c(F)c1 |r,wU:10.21,13.17,c:8,(1.16,4.67,;1.93,3.33,;3.47,3.33,;4.24,2,;3.47,.67,;1.93,.67,;1.16,2,;-.38,2,;-1.29,.75,;-.52,-.58,;-2.75,1.23,;-4.09,2,;-5.42,1.23,;-5.42,-.31,;-4.09,-1.08,;-2.75,-.31,;-6.75,.46,;-8.09,-.31,;-6.75,2,;-8.09,1.23,;-2.75,2.77,;-1.29,3.25,;-.52,4.58,;4.24,-.67,;3.47,-2,;4.24,-3.33,;5.78,-3.33,;6.55,-4.67,;6.55,-2,;8.09,-2,;5.78,-.67,)|
BDBM220137 COC[C@H]1CC[C@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)cc1 |r,wU:6.9,3.2,c:13,(-7.98,.46,;-6.65,-.31,;-5.32,.46,;-3.98,-.31,;-3.98,1.23,;-2.65,2,;-1.32,1.23,;-1.32,-.31,;-2.65,-1.08,;-1.32,2.77,;.15,3.25,;.92,4.58,;1.05,2,;.15,.75,;.92,-.58,;2.59,2,;3.36,.67,;4.9,.67,;5.67,2,;4.9,3.33,;3.36,3.33,;2.59,4.67,;5.67,-.67,;4.9,-2,;5.67,-3.33,;7.21,-3.33,;7.98,-4.67,;7.98,-2,;7.21,-.67,)|
BDBM220130 CO[C@@]1(C)CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)cc1 |r,wU:6.9,2.2,wD:2.1,c:13,(-6.65,-2.62,;-5.32,-1.85,;-5.32,-.31,;-6.65,.46,;-3.98,-1.08,;-2.65,-.31,;-2.65,1.23,;-3.98,2,;-5.32,1.23,;-2.65,2.77,;-1.18,3.25,;-.41,4.58,;-.28,2,;-1.18,.75,;-.41,-.58,;1.26,2,;2.03,.67,;3.57,.67,;4.34,2,;3.57,3.33,;2.03,3.33,;1.26,4.67,;4.34,-.67,;3.57,-2,;4.34,-3.33,;5.88,-3.33,;6.65,-4.67,;6.65,-2,;5.88,-.67,)|
BDBM220139 COC[C@H]1CC[C@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)c(F)c1 |r,wU:6.9,3.2,c:13,(-8.75,.46,;-7.42,-.31,;-6.09,.46,;-4.75,-.31,;-4.75,1.23,;-3.42,2,;-2.09,1.23,;-2.09,-.31,;-3.42,-1.08,;-2.09,2.77,;-.62,3.25,;.15,4.58,;.28,2,;-.62,.75,;.15,-.58,;1.82,2,;2.59,.67,;4.13,.67,;4.9,2,;4.13,3.33,;2.59,3.33,;1.82,4.67,;4.9,-.67,;4.13,-2,;4.9,-3.33,;6.44,-3.33,;7.21,-4.67,;7.21,-2,;8.75,-2,;6.44,-.67,)|
BDBM220140 CO[C@]1(CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)cc1)C(F)(F)F |r,wU:5.8,2.31,wD:2.1,c:12,(-5.98,-2.62,;-4.65,-1.85,;-4.65,-.31,;-3.32,-1.08,;-1.98,-.31,;-1.98,1.23,;-3.32,2,;-4.65,1.23,;-1.98,2.77,;-.52,3.25,;.25,4.58,;.39,2,;-.52,.75,;.25,-.58,;1.93,2,;2.7,.67,;4.24,.67,;5.01,2,;4.24,3.33,;2.7,3.33,;1.93,4.67,;5.01,-.67,;4.24,-2,;5.01,-3.33,;6.55,-3.33,;7.32,-4.67,;7.32,-2,;6.55,-.67,;-5.98,.46,;-7.32,-.31,;-5.98,2,;-7.32,1.23,)|
BDBM220141 CO[C@]1(CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)c(F)c1)C(F)(F)F |r,wU:5.8,2.32,wD:2.1,c:12,(-6.75,-2.62,;-5.42,-1.85,;-5.42,-.31,;-4.09,-1.08,;-2.75,-.31,;-2.75,1.23,;-4.09,2,;-5.42,1.23,;-2.75,2.77,;-1.29,3.25,;-.52,4.58,;-.38,2,;-1.29,.75,;-.52,-.58,;1.16,2,;1.93,.67,;3.47,.67,;4.24,2,;3.47,3.33,;1.93,3.33,;1.16,4.67,;4.24,-.67,;3.47,-2,;4.24,-3.33,;5.78,-3.33,;6.55,-4.67,;6.55,-2,;8.09,-2,;5.78,-.67,;-6.75,.46,;-8.09,-.31,;-6.75,2,;-8.09,1.23,)|
BDBM220142 COC[C@@]1(CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)cc1)OC |r,wU:6.9,3.2,wD:3.32,c:13,(-7.98,.46,;-6.65,-.31,;-5.32,.46,;-3.98,-.31,;-2.65,-1.08,;-1.32,-.31,;-1.32,1.23,;-2.65,2,;-3.98,1.23,;-1.32,2.77,;.15,3.25,;.92,4.58,;1.05,2,;.15,.75,;.92,-.58,;2.59,2,;3.36,.67,;4.9,.67,;5.67,2,;4.9,3.33,;3.36,3.33,;2.59,4.67,;5.67,-.67,;4.9,-2,;5.67,-3.33,;7.21,-3.33,;7.98,-4.67,;7.98,-2,;7.21,-.67,;-3.98,-1.85,;-5.32,-2.62,)|
BDBM220143 COC[C@@]1(CC[C@@]2(CC1)NC(=O)C(=C2O)c1cc(ccc1C)-c1ccc(Cl)c(F)c1)OC |r,wU:6.9,3.2,wD:3.33,c:13,(-8.75,.46,;-7.42,-.31,;-6.09,.46,;-4.75,-.31,;-3.42,-1.08,;-2.09,-.31,;-2.09,1.23,;-3.42,2,;-4.75,1.23,;-2.09,2.77,;-.62,3.25,;.15,4.58,;.28,2,;-.62,.75,;.15,-.58,;1.82,2,;2.59,.67,;4.13,.67,;4.9,2,;4.13,3.33,;2.59,3.33,;1.82,4.67,;4.9,-.67,;4.13,-2,;4.9,-3.33,;6.44,-3.33,;7.21,-4.67,;7.21,-2,;8.75,-2,;6.44,-.67,;-4.75,-1.85,;-6.09,-2.62,)|