BindingDB logo
myBDB logout

1 SMILES String for Acetyl-Coenzyme A carboxylase

Compound NameSMILES String
BDBM50446514 CCOc1ccc(N2CCN([C@@H](C)C2)c2noc(n2)C2(CCC2)NC(C)=O)c(C)c1 |r|