BindingDB logo
myBDB logout

9 SMILES Strings for Acetylcholine receptor protein epsilon chain

Compound NameSMILES String
BDBM8961 Nc1c2CCCCc2nc2ccccc12
BDBM50177174 Nc1c2CCCCc2nc2c(CO)cccc12
BDBM50448372 C[N+](C)(CCCCCCC[N+](C)(C)CC#CCOC1=NOCC1)CCCN1C(=O)c2ccccc2C1=O |t:18|
BDBM50448374 C[N+](C)(CCCCCC[N+](C)(C)CC#CCOC1=NOCC1)CCCN1C(=O)c2cccc3cccc(C1=O)c23 |t:17|
BDBM50448375 C[N+](C)(CCCCCCCC[N+](C)(C)CC#CCOC1=NOCC1)CCCN1C(=O)c2cccc3cccc(C1=O)c23 |t:19|
BDBM50448376 CC(C)(CN1C(=O)c2cccc3cccc(C1=O)c23)C[N+](C)(C)CCCCCC[N+](C)(C)CCCN1C(=O)c2ccccc2C1=O
BDBM50448369 C[N+](C)(CCCCCCCC[N+](C)(C)CC#CCOC1=NOCC1)CCCN1C(=O)c2ccccc2C1=O |t:19|
BDBM50448370 C[N+](C)(CCCCCCC[N+](C)(C)CC#CCOC1=NOCC1)CCCN1C(=O)c2cccc3cccc(C1=O)c23 |t:18|
BDBM50448371 C[N+](C)(CCCCCC[N+]1(C)CCC(CC1)N1C(=O)c2cccc3cccc(C1=O)c23)CC#CCOC1=NOCC1 |t:40,(26.01,-22.81,;26.76,-24.15,;27.54,-22.83,;25.23,-24.16,;24.45,-22.84,;22.91,-22.84,;22.13,-21.52,;20.59,-21.53,;19.81,-20.19,;18.27,-20.2,;19.03,-18.86,;17.49,-18.87,;15.95,-18.88,;15.19,-20.22,;15.97,-21.55,;17.51,-21.54,;13.65,-20.23,;12.88,-18.89,;13.64,-17.57,;11.35,-18.91,;10.58,-17.58,;9.05,-17.57,;8.28,-18.91,;9.04,-20.25,;8.28,-21.58,;9.06,-22.91,;10.59,-22.9,;11.35,-21.57,;12.9,-21.56,;13.67,-22.88,;10.58,-20.24,;27.53,-25.5,;29.07,-25.51,;30.61,-25.5,;32.15,-25.5,;32.92,-26.83,;34.46,-26.82,;35.38,-28.05,;36.84,-27.57,;36.83,-26.03,;35.37,-25.56,)|