BindingDB logo
myBDB logout

5 SMILES Strings for Acetylcholinesterase (AChE)

Compound NameSMILES String
BDBM82305 O=C(C[n+]1ccccc1)NN=Cc1ccc(C=NNC(=O)C[n+]2ccccc2)cc1 |w:10.10,16.16|
BDBM50060533 C[N+](C)(C)CCCCCCCCCCCC[N+](C)(C)C
BDBM50060582 C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C
BDBM50119793 C(CCCCCC[n+]1ccccc1)CCCCC[n+]1ccccc1
BDBM50119779 C(CCCCC[n+]1ccccc1)CCCC[n+]1ccccc1