BindingDB logo
myBDB logout

15 SMILES Strings for Acetylpolyamine amidohydrolase (APAH)

Compound NameSMILES String
BDBM152728 [NH3+]CCCCC(=O)NO
BDBM152729 [NH3+]CCCCCC(=O)NO
BDBM152730 [NH3+]CCCCCCC(=O)NO
BDBM152731 [NH3+]CCCCCCCC(=O)NO
BDBM50121062 FC(F)(F)C(=O)CCCCCCC(=O)Nc1ccccc1
BDBM50405937 CC(=O)CCCCCNCCCN
BDBM50438384 NCCCNCCCCCB(O)O
BDBM50438385 CS(=O)(=O)CCCCCNCCCN
BDBM50438386 NCCCNCCCCCS
BDBM50438387 CC(=O)SCCCCCNCCCN
BDBM50438388 COCC(=O)CCCCCNCCCN
BDBM50438389 CC(=O)SCC(=O)CCCCCNCCCN
BDBM50438390 NCCCNCCCCCC(=O)C(F)(F)F
BDBM50438391 NCCCNCCCCCC(=O)NO
BDBM50438393 NCCCNCCCCCC(O)=O