BindingDB logo
myBDB logout

23 SMILES Strings for Acetylpolyamine oxidase (APAO)

Compound NameSMILES String
BDBM152706 Clc1ccc(NC(=N)NC(=N)NCCCCCCNC(=N)NC(=N)Nc2ccc(Cl)cc2)cc1
BDBM50018055 CC(=O)CCCCCN
BDBM50015358 C=C=CCNCCCCNCC=C=C
BDBM50026230 CNCCCCNCC#C
BDBM50026231 NCCCCNCC=C=C
BDBM50026232 CNCCCCNCC=C=C
BDBM50026233 NCCCCNCC#C
BDBM50405928 CC(=O)NCCCCCCCCN
BDBM50405929 CS(=O)(=O)NCCCCCCN
BDBM50405930 NCCCCCCNC(=O)CCl
BDBM50405931 CCN(CC)CCCNCCCCCC(C)=O
BDBM50405932 CCCNCCCCNC(C)=O
BDBM50405933 CC(=O)NCCCNCCCCN
BDBM50405934 COC(=O)NCCCCCCCCN
BDBM50405935 CC(=O)NCCCCCCN
BDBM50405936 CCCC(=O)NCCCCN
BDBM50405937 CC(=O)CCCCCNCCCN
BDBM50405938 CC(=O)NCCCCN
BDBM50405939 CC(=O)CCCCCNCCCN1CCOCC1
BDBM50405940 CC(=O)NCCCCCCCCCCN
BDBM50405941 CS(=O)(=O)NCCCCCCCCN
BDBM50405942 CN1CCN(CCCCCC(C)=O)CC1
BDBM50405943 CN(C)CCCNCCCCCC(C)=O