BindingDB logo
myBDB logout

8 SMILES Strings for Acid phosphatase (acpA)

Compound NameSMILES String
BDBM7462 Oc1ccc(cc1)-c1oc2cc(O)cc(O)c2c(=O)c1O
BDBM15236 Oc1cc(O)c2c(c1)oc(-c1cc(O)c(O)c(O)c1)c(O)c2=O
BDBM39344 CCN(CC)CCNC(=O)c1ccc(N)cc1
BDBM59083 CCCCCCCCCCCCCCCC[N+](C)(C)CCN(Cc1ccc(OC)cc1)c1ncccn1
BDBM92476 CC1(C)OC[C@H](O1)[C@H]1OC(=O)C(=O)C1O
BDBM92477 OCC(O)c1oc(=O)[c-](OP([O-])([O-])=O)c1O
BDBM92478 COc1ccc(CC2c3cc(OC)c(OC)cc3CC[N+]2(C)CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCc3cc(OC)c(OC)cc3C2Cc2ccc(OC)c(OC)c2)cc1OC
BDBM50090256 OC[C@H](O)c1oc(O)c(O)c1O |r|