BindingDB logo
myBDB logout

2 SMILES Strings for Acidic mammalian chitinase

Compound NameSMILES String
BDBM81508 Cn1cnc2n(C)c(=O)n(CCCn3c(=O)n(C)c4ncn(C)c4c3=O)c(=O)c12
BDBM50388141 Cn1cnc2n(C)c(=O)n(CCn3c(=O)n(C)c4ncn(C)c4c3=O)c(=O)c12