BindingDB logo
myBDB logout

19 SMILES Strings for Acidic mammalian chitinase (AMCase)

Compound NameSMILES String
BDBM10880 CC(=O)Nc1nnc(s1)S(N)(=O)=O
BDBM39302 C(Nc1ncnc2nc[nH]c12)c1ccco1
BDBM72759 Cc1[nH]c2ccccc2c1CN1CCN(CC1)c1ccccn1
BDBM81508 Cn1cnc2n(C)c(=O)n(CCCn3c(=O)n(C)c4ncn(C)c4c3=O)c(=O)c12
BDBM81509 Cn1cnc2n(C)c(=O)n(CCCn3c(=O)n(C)c4nc[nH]c4c3=O)c(=O)c12
BDBM50027028 NC(=O)c1cccnc1N1CCNCC1
BDBM50173286 CNC(=O)NC(N)=NCCC[C@@H]1NC(=O)[C@@H](C)NC(=O)C[C@H](NC(=O)C[C@H](NC(=O)[C@H](Cc2ccccc2)N(C)C1=O)C(O)=O)C(O)=O |r,w:7.7|
BDBM50331851 CN(C)C1=N[C@@H]2[C@@H](O)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]4NC(C)=O)[C@@H](O)[C@H]3NC(C)=O)[C@@H](CO)[C@@H]2O1 |r,t:3|
BDBM50331852 Cn1c2nc(Cl)[nH]c2c(=O)n(C)c1=O
BDBM50378795 Nc1nnc([nH]1)N1CCN(CCOc2ccc(Br)cc2)CC1
BDBM50378796 NC(=N)N1CCN(CC1)c1ccc(Cl)cc1
BDBM50378797 CCNC(=O)c1cccnc1N1CCN(C)CC1
BDBM50438377 NC(NN=Cc1ccco1)=NN=Cc1ccco1 |w:12.13,10.11,3.2|
BDBM50438372 COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C3CC3)cc2)nc(OC)n1
BDBM50438373 CCOc1cc([CH+][N-][N-]C(=[SH+])NCC=C)cc(c1O)[N+]([O-])=O
BDBM50438374 Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C=C)cc2)no1
BDBM50438375 CCC(=O)NC(=S)Nc1ccc2oc(nc2c1)-c1ccccc1
BDBM50438376 CNC(=S)NNC(=O)c1oc2nc(cc(C)c2c1N)-c1ccccc1
BDBM50438378 CN(C)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NNC(N)=S)cc1 |w:7.6|