BindingDB logo
myBDB logout

30 SMILES Strings for Acyl carrier protein, mitochondrial

Compound NameSMILES String
BDBM50130143 CCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCC
BDBM50411082 CCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCCCC
BDBM50411083 CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CC
BDBM50411084 CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCC
BDBM50411085 CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCCCCCC |r|
BDBM50411086 CCCC(CCC)CCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCC(CCC)CCC
BDBM50411087 CCCCCCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCC
BDBM50411088 CCCCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCCCCCCCC
BDBM50411089 CCCCCCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@@H](C)O
BDBM50411090 CCCCC(CC)CCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCC(CC)CCCC
BDBM50411091 CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCC(CCC)CCC
BDBM50411092 CCCCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@H](O)CCCCCCCC
BDBM50411093 CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H](O1)[C@H]1CC[C@@H](O1)[C@@H](C)O
BDBM50411903 CCCC1(O)C(=O)C(C)C(=O)N=C1C=CC(C)C\C=C\C(C)C |w:13.13,c:11|
BDBM50411904 CCCc1c(C\C=C(/C)C\C=C\C(C)C)[nH]c(=O)c(C)c1O
BDBM50411905 COc1nc(CC=C(C)C\C=C\C(\C)=C\[C@@H](C)[C@@H](O)C(\C)=C\C)c(C)c(O)c1OC |w:6.5|
BDBM50411906 CCCc1c(C\C=C(/C)C\C=C\C(C)(C)C)oc(=O)c(C)c1O
BDBM50411907 CCCc1c(C\C=C(/C)C\C=C\C(C)(C)C)[nH]c(=O)c(C)c1O
BDBM50411908 CCCCC\C(C)=C\Cc1oc(=O)c(C)c(O)c1CCC
BDBM50411909 CCCCC\C(C)=C\Cc1[nH]c(=O)c(C)c(O)c1CCC
BDBM50411910 CCCc1c(C\C=C(/C)C\C=C\C(C)C)[nH]c(=O)c(C)c1OC
BDBM50411911 CCCc1c(O)c(C)c(=O)[nH]c1CCC(C)CCCC(C)C
BDBM50411912 CCCc1c(C\C=C(/C)C\C=C\C(C)O)[nH]c(=O)c(C)c1O
BDBM50411913 CCCc1c(C\C=C(/C)C\C=C\CC)[nH]c(=O)c(C)c1O
BDBM50411914 CCCc1c(C\C=C(/C)C\C=C\C(C)(C)O)[nH]c(=O)c(C)c1O
BDBM50411915 CCCc1c(C\C=C(/C)C\C=C\C(C)C)oc(=O)c(C)c1O
BDBM50411916 CCCc1c(C\C=C(/C)C\C=C\C(C)C)[nH]c(=O)c(C)c1OC(C)=O
BDBM50411917 CCCc1c(C\C=C(/C)C\C=C\C(C)(C)O)[nH]c(=O)c(C)c1OC
BDBM50411918 CCCC1C(C=CC(C)C\C=C\C(C)C)=NC(=O)C(C)(O)C1=O |w:5.4,c:14|
BDBM50411919 CCCc1c(C\C=C(/C)C\C=C\C(C)(C)O)[nH]c(=O)c(C)c1OC(C)=O