BindingDB logo
myBDB logout

4 SMILES Strings for Acyl-CoA:dihydroxyacetonephosphateacyltransferase

Compound NameSMILES String
BDBM50068940 CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCC(NN)C(O)=O)C(O)=O
BDBM50068941 CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCC(=O)C([O-])=O)C([O-])=O
BDBM50068942 CC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCC(NN)C(O)=O)C(O)=O
BDBM50068943 NNC(CCC[C@H](NC(=O)CCC(O)=O)C(O)=O)C(O)=O