BindingDB logo
myBDB logout

1 SMILES String for Acyl-protein thioesterase 1/2

Compound NameSMILES String
BDBM50031282 NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |r|