BindingDB logo
myBDB logout

2 SMILES Strings for Acyl-protein thioesterase 2 (APT2 P86Q)

Compound NameSMILES String
BDBM207991 FC(F)(F)c1ccc(Cl)c(NC(=O)CN2CCN(CC2)C(=O)c2ccco2)c1
BDBM207992 COc1ccc(cc1)N1CCN(CC1)C(=O)c1cc2CS(=O)(=O)c3ccccc3-c2s1