BindingDB logo
myBDB logout

4 SMILES Strings for Acyl-protein thioesterase 2 (APT2 S122A)

Compound NameSMILES String
BDBM207992 COc1ccc(cc1)N1CCN(CC1)C(=O)c1cc2CS(=O)(=O)c3ccccc3-c2s1
BDBM207993 OC(=O)c1ccc(cc1C1C2C=CC(=O)C=C2Oc2cc(O)ccc12)C(=O)NCCOCCOCCOCCn1cc(COc2ccc(cc2)N2CCN(CC2)C(=O)c2cc3CS(=O)(=O)c4ccccc4-c3s2)nn1 |c:12,16|
BDBM207994 COc1ccc(cc1)N1CCN(CC1)C(=O)c1cc2CS(=O)c3ccccc3-c2s1
BDBM207995 COc1ccc(cc1)N1CCN(CC1)C(=O)c1cc2CSc3ccccc3-c2s1